About 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole
4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole (PubChem CID 164872106) has the molecular formula C13H13F3N2S
and a molecular weight of 286.32 g/mol. Its IUPAC name is 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole |
| PubChem CID | 164872106 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole |
| SMILES | FC(F)(F)CCn1cc(SCc2ccccc2)cn1 |
| InChI | InChI=1S/C13H13F3N2S/c14-13(15,16)6-7-18-9-12(8-17-18)19-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2 |
| InChIKey | MBVBLYOVYONWRV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole?
The IUPAC name of 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole (CID 164872106) is 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole.
What is the SMILES notation for 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole?
The canonical SMILES for 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole is FC(F)(F)CCn1cc(SCc2ccccc2)cn1.
What is the InChIKey of 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole?
The InChIKey is MBVBLYOVYONWRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2S/c14-13(15,16)6-7-18-9-12(8-17-18)19-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2.
What are the key properties of 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole?
4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole has a molecular weight of 286.32 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-1-(3,3,3-trifluoropropyl)pyrazole is sourced from PubChem (CID 164872106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).