About 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline
3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline (PubChem CID 164873208) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline |
| PubChem CID | 164873208 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline |
| SMILES | Cc1cc(N)cc(C)c1N1CC2(CN(C)C2)C1 |
| InChI | InChI=1S/C14H21N3/c1-10-4-12(15)5-11(2)13(10)17-8-14(9-17)6-16(3)7-14/h4-5H,6-9,15H2,1-3H3 |
| InChIKey | LWVAFQSQVYBLLR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline?
The IUPAC name of 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline (CID 164873208) is 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline.
What is the SMILES notation for 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline?
The canonical SMILES for 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline is Cc1cc(N)cc(C)c1N1CC2(CN(C)C2)C1.
What is the InChIKey of 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline?
The InChIKey is LWVAFQSQVYBLLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-10-4-12(15)5-11(2)13(10)17-8-14(9-17)6-16(3)7-14/h4-5H,6-9,15H2,1-3H3.
What are the key properties of 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline?
3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline has a molecular weight of 231.34 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline is sourced from PubChem (CID 164873208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).