C12H19NO — CID 164873417
7-methylidene-5-(oxan-4-yl)-1,2,3,6-tetrahydroazepine (PubChem CID 164873417) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 7-methylidene-5-(oxan-4-yl)-1,2,3,6-tetrahydroazepine.
| Compound Name | 7-methylidene-5-(oxan-4-yl)-1,2,3,6-tetrahydroazepine |
|---|---|
| PubChem CID | 164873417 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 7-methylidene-5-(oxan-4-yl)-1,2,3,6-tetrahydroazepine |
| SMILES | C=C1CC(C2CCOCC2)=CCCN1 |
| InChI | InChI=1S/C12H19NO/c1-10-9-12(3-2-6-13-10)11-4-7-14-8-5-11/h3,11,13H,1-2,4-9H2 |
| InChIKey | QKZANEXIGLPONY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|