C22H29N3O2 — CID 164873686
1-[2-[1-acetyl-4-(4-methylphenyl)imidazol-2-yl]piperidin-1-yl]-2-methylbutan-1-one (PubChem CID 164873686) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[2-[1-acetyl-4-(4-methylphenyl)imidazol-2-yl]piperidin-1-yl]-2-methylbutan-1-one.
| Compound Name | 1-[2-[1-acetyl-4-(4-methylphenyl)imidazol-2-yl]piperidin-1-yl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 164873686 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[2-[1-acetyl-4-(4-methylphenyl)imidazol-2-yl]piperidin-1-yl]-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)N1CCCCC1c1nc(-c2ccc(C)cc2)cn1C(C)=O |
| InChI | InChI=1S/C22H29N3O2/c1-5-16(3)22(27)24-13-7-6-8-20(24)21-23-19(14-25(21)17(4)26)18-11-9-15(2)10-12-18/h9-12,14,16,20H,5-8,13H2,1-4H3 |
| InChIKey | YPWRLOGRJMKCDP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |