C28H29FN4O5S — CID 164873745
tert-butyl N-[(3R)-8-fluoro-7-[(Z)-N'-hydroxycarbamimidoyl]-4-oxo-5-[(4-phenoxyphenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate (PubChem CID 164873745) has the molecular formula C28H29FN4O5S and a molecular weight of 552.63 g/mol. Its IUPAC name is tert-butyl N-[(3R)-8-fluoro-7-[(Z)-N'-hydroxycarbamimidoyl]-4-oxo-5-[(4-phenoxyphenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-8-fluoro-7-[(Z)-N'-hydroxycarbamimidoyl]-4-oxo-5-[(4-phenoxyphenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 164873745 |
| Molecular Formula | C28H29FN4O5S |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | tert-butyl N-[(3R)-8-fluoro-7-[(Z)-N'-hydroxycarbamimidoyl]-4-oxo-5-[(4-phenoxyphenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CSc2cc(F)c(/C(N)=N/O)cc2N(Cc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C28H29FN4O5S/c1-28(2,3)38-27(35)31-22-16-39-24-14-21(29)20(25(30)32-36)13-23(24)33(26(22)34)15-17-9-11-19(12-10-17)37-18-7-5-4-6-8-18/h4-14,22,36H,15-16H2,1-3H3,(H2,30,32)(H,31,35)/t22-/m0/s1 |
| InChIKey | HZVOBACNVWKENY-QFIPXVFZSA-N |
| XLogP | 5.24 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|