C21H18ClF3N4O2S — CID 164874164
7-[5-(2-amino-1,1,1-trifluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-[(4-chlorophenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 164874164) has the molecular formula C21H18ClF3N4O2S and a molecular weight of 482.92 g/mol. Its IUPAC name is 7-[5-(2-amino-1,1,1-trifluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-[(4-chlorophenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | 7-[5-(2-amino-1,1,1-trifluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-[(4-chlorophenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 164874164 |
| Molecular Formula | C21H18ClF3N4O2S |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 7-[5-(2-amino-1,1,1-trifluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-[(4-chlorophenyl)methyl]-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | CC(N)(c1nnc(-c2ccc3c(c2)N(Cc2ccc(Cl)cc2)C(=O)CCS3)o1)C(F)(F)F |
| InChI | InChI=1S/C21H18ClF3N4O2S/c1-20(26,21(23,24)25)19-28-27-18(31-19)13-4-7-16-15(10-13)29(17(30)8-9-32-16)11-12-2-5-14(22)6-3-12/h2-7,10H,8-9,11,26H2,1H3 |
| InChIKey | AWKNGLGLVLGEJV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |