About 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane
6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane (PubChem CID 164875306) has the molecular formula C20H35F2NO
and a molecular weight of 343.50 g/mol. Its IUPAC name is 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane.
Molecular Properties
| Compound Name | 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane |
| PubChem CID | 164875306 |
| Molecular Formula | C20H35F2NO |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane |
| SMILES | CCC.CCCNCCCCCCOCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C17H27F2NO.C3H8/c1-2-12-20-13-8-3-4-9-14-21-15-17(18,19)16-10-6-5-7-11-16;1-3-2/h5-7,10-11,20H,2-4,8-9,12-15H2,1H3;3H2,1-2H3 |
| InChIKey | OMVVCJVKSZXJCP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane?
The IUPAC name of 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane (CID 164875306) is 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane.
What is the SMILES notation for 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane?
The canonical SMILES for 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane is CCC.CCCNCCCCCCOCC(F)(F)c1ccccc1.
What is the InChIKey of 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane?
The InChIKey is OMVVCJVKSZXJCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27F2NO.C3H8/c1-2-12-20-13-8-3-4-9-14-21-15-17(18,19)16-10-6-5-7-11-16;1-3-2/h5-7,10-11,20H,2-4,8-9,12-15H2,1H3;3H2,1-2H3.
What are the key properties of 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane?
6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane has a molecular weight of 343.50 g/mol, XLogP of 5.77, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoro-2-phenylethoxy)-N-propylhexan-1-amine;propane is sourced from PubChem (CID 164875306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).