About (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine
(1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine (PubChem CID 164875323) has the molecular formula C14H23F2NO
and a molecular weight of 259.34 g/mol. Its IUPAC name is (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine.
Molecular Properties
| Compound Name | (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine |
| PubChem CID | 164875323 |
| Molecular Formula | C14H23F2NO |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine |
| SMILES | CCCCCN.COCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C9H10F2O.C5H13N/c1-12-7-9(10,11)8-5-3-2-4-6-8;1-2-3-4-5-6/h2-6H,7H2,1H3;2-6H2,1H3 |
| InChIKey | NZBXDGYSXLZETF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine?
The IUPAC name of (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine (CID 164875323) is (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine.
What is the SMILES notation for (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine?
The canonical SMILES for (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine is CCCCCN.COCC(F)(F)c1ccccc1.
What is the InChIKey of (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine?
The InChIKey is NZBXDGYSXLZETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2O.C5H13N/c1-12-7-9(10,11)8-5-3-2-4-6-8;1-2-3-4-5-6/h2-6H,7H2,1H3;2-6H2,1H3.
What are the key properties of (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine?
(1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine has a molecular weight of 259.34 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-difluoro-2-methoxyethyl)benzene;pentan-1-amine is sourced from PubChem (CID 164875323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).