C23H27BrFIN4O4 — CID 164875451
tert-butyl (1S,4S)-5-[7-bromo-8-fluoro-6-iodo-2-(oxan-4-yloxy)quinazolin-4-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 164875451) has the molecular formula C23H27BrFIN4O4 and a molecular weight of 649.30 g/mol. Its IUPAC name is tert-butyl (1S,4S)-5-[7-bromo-8-fluoro-6-iodo-2-(oxan-4-yloxy)quinazolin-4-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1S,4S)-5-[7-bromo-8-fluoro-6-iodo-2-(oxan-4-yloxy)quinazolin-4-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 164875451 |
| Molecular Formula | C23H27BrFIN4O4 |
| Molecular Weight | 649.30 g/mol |
| Exact Mass | 648.02 |
| IUPAC Name | tert-butyl (1S,4S)-5-[7-bromo-8-fluoro-6-iodo-2-(oxan-4-yloxy)quinazolin-4-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1CN2c1nc(OC2CCOCC2)nc2c(F)c(Br)c(I)cc12 |
| InChI | InChI=1S/C23H27BrFIN4O4/c1-23(2,3)34-22(31)30-11-12-8-13(30)10-29(12)20-15-9-16(26)17(24)18(25)19(15)27-21(28-20)33-14-4-6-32-7-5-14/h9,12-14H,4-8,10-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | XQFKYNOVQQFPRB-STQMWFEESA-N |
| XLogP | 4.89 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|