About ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine
ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine (PubChem CID 164876604) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine.
Molecular Properties
| Compound Name | ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine |
| PubChem CID | 164876604 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine |
| SMILES | CC.CC(C)C1(C)C=CC=Cc2nnnn21 |
| InChI | InChI=1S/C10H14N4.C2H6/c1-8(2)10(3)7-5-4-6-9-11-12-13-14(9)10;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | XCKNPOVHNDLOPT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine?
The IUPAC name of ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine (CID 164876604) is ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine.
What is the SMILES notation for ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine?
The canonical SMILES for ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine is CC.CC(C)C1(C)C=CC=Cc2nnnn21.
What is the InChIKey of ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine?
The InChIKey is XCKNPOVHNDLOPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4.C2H6/c1-8(2)10(3)7-5-4-6-9-11-12-13-14(9)10;1-2/h4-8H,1-3H3;1-2H3.
What are the key properties of ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine?
ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine has a molecular weight of 220.32 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-5-propan-2-yltetrazolo[1,5-a]azepine is sourced from PubChem (CID 164876604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).