About methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde
methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 164877104) has the molecular formula C10H18N4O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde |
| PubChem CID | 164877104 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | CC1CC(NCc2noc(C=O)n2)C1.CN |
| InChI | InChI=1S/C9H13N3O2.CH5N/c1-6-2-7(3-6)10-4-8-11-9(5-13)14-12-8;1-2/h5-7,10H,2-4H2,1H3;2H2,1H3 |
| InChIKey | QHVMGTIFPLEIAT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde?
The IUPAC name of methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde (CID 164877104) is methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde.
What is the SMILES notation for methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde?
The canonical SMILES for methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde is CC1CC(NCc2noc(C=O)n2)C1.CN.
What is the InChIKey of methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde?
The InChIKey is QHVMGTIFPLEIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2.CH5N/c1-6-2-7(3-6)10-4-8-11-9(5-13)14-12-8;1-2/h5-7,10H,2-4H2,1H3;2H2,1H3.
What are the key properties of methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde?
methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde has a molecular weight of 226.28 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;3-[[(3-methylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carbaldehyde is sourced from PubChem (CID 164877104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).