About ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol
ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol (PubChem CID 164877253) has the molecular formula C11H23F2NO
and a molecular weight of 223.31 g/mol. Its IUPAC name is ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 164877253 |
| Molecular Formula | C11H23F2NO |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol |
| SMILES | CC.CCC1CC(NCC(F)(F)CO)C1 |
| InChI | InChI=1S/C9H17F2NO.C2H6/c1-2-7-3-8(4-7)12-5-9(10,11)6-13;1-2/h7-8,12-13H,2-6H2,1H3;1-2H3 |
| InChIKey | IDRYUZWUCRLTJH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol?
The IUPAC name of ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol (CID 164877253) is ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol is CC.CCC1CC(NCC(F)(F)CO)C1.
What is the InChIKey of ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol?
The InChIKey is IDRYUZWUCRLTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO.C2H6/c1-2-7-3-8(4-7)12-5-9(10,11)6-13;1-2/h7-8,12-13H,2-6H2,1H3;1-2H3.
What are the key properties of ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol?
ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol has a molecular weight of 223.31 g/mol, XLogP of 2.42, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[(3-ethylcyclobutyl)amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 164877253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).