About ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide
ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 164877262) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide.
Molecular Properties
| Compound Name | ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide |
| PubChem CID | 164877262 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC.CCC1CC(NCc2noc(C(N)=O)n2)C1 |
| InChI | InChI=1S/C10H16N4O2.C2H6/c1-2-6-3-7(4-6)12-5-8-13-10(9(11)15)16-14-8;1-2/h6-7,12H,2-5H2,1H3,(H2,11,15);1-2H3 |
| InChIKey | LZUSXNJKBDHXDV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide?
The IUPAC name of ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide (CID 164877262) is ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide.
What is the SMILES notation for ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide?
The canonical SMILES for ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide is CC.CCC1CC(NCc2noc(C(N)=O)n2)C1.
What is the InChIKey of ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide?
The InChIKey is LZUSXNJKBDHXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2.C2H6/c1-2-6-3-7(4-6)12-5-8-13-10(9(11)15)16-14-8;1-2/h6-7,12H,2-5H2,1H3,(H2,11,15);1-2H3.
What are the key properties of ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide?
ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide has a molecular weight of 254.33 g/mol, XLogP of 1.47, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[[(3-ethylcyclobutyl)amino]methyl]-1,2,4-oxadiazole-5-carboxamide is sourced from PubChem (CID 164877262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).