C20H21N3O3 — CID 164877338
(3S)-6-[3-(3,5-dimethylphenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-3-ol (PubChem CID 164877338) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (3S)-6-[3-(3,5-dimethylphenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-3-ol.
| Compound Name | (3S)-6-[3-(3,5-dimethylphenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-3-ol |
|---|---|
| PubChem CID | 164877338 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (3S)-6-[3-(3,5-dimethylphenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-3-ol |
| SMILES | Cc1cc(C)cc(-c2noc(-c3cnc4c(c3)C[C@H](O)C(C)(C)O4)n2)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-11-5-12(2)7-13(6-11)17-22-19(26-23-17)15-8-14-9-16(24)20(3,4)25-18(14)21-10-15/h5-8,10,16,24H,9H2,1-4H3/t16-/m0/s1 |
| InChIKey | QAAWGBUNTMBIAC-INIZCTEOSA-N |
| XLogP | 3.49 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |