C21H18Cl2FN5OS — CID 164877587
4-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-fluorobenzamide (PubChem CID 164877587) has the molecular formula C21H18Cl2FN5OS and a molecular weight of 478.38 g/mol. Its IUPAC name is 4-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-fluorobenzamide.
| Compound Name | 4-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 164877587 |
| Molecular Formula | C21H18Cl2FN5OS |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 4-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-fluorobenzamide |
| SMILES | Cc1cc(CNC(=O)c2ccc(SNc3ccc(Cl)c4c(Cl)c[nH]c34)c(F)c2)nn1C |
| InChI | InChI=1S/C21H18Cl2FN5OS/c1-11-7-13(27-29(11)2)9-26-21(30)12-3-6-18(16(24)8-12)31-28-17-5-4-14(22)19-15(23)10-25-20(17)19/h3-8,10,25,28H,9H2,1-2H3,(H,26,30) |
| InChIKey | SZLGLSSOUSUFHG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|