About 4-(4-propylphenyl)-1,2,4-triazole
4-(4-propylphenyl)-1,2,4-triazole (PubChem CID 164877919) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 4-(4-propylphenyl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 4-(4-propylphenyl)-1,2,4-triazole |
| PubChem CID | 164877919 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4-(4-propylphenyl)-1,2,4-triazole |
| SMILES | CCCc1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C11H13N3/c1-2-3-10-4-6-11(7-5-10)14-8-12-13-9-14/h4-9H,2-3H2,1H3 |
| InChIKey | SYVSZPDGNSWZIX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-propylphenyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-propylphenyl)-1,2,4-triazole?
The IUPAC name of 4-(4-propylphenyl)-1,2,4-triazole (CID 164877919) is 4-(4-propylphenyl)-1,2,4-triazole.
What is the SMILES notation for 4-(4-propylphenyl)-1,2,4-triazole?
The canonical SMILES for 4-(4-propylphenyl)-1,2,4-triazole is CCCc1ccc(-n2cnnc2)cc1.
What is the InChIKey of 4-(4-propylphenyl)-1,2,4-triazole?
The InChIKey is SYVSZPDGNSWZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-2-3-10-4-6-11(7-5-10)14-8-12-13-9-14/h4-9H,2-3H2,1H3.
What are the key properties of 4-(4-propylphenyl)-1,2,4-triazole?
4-(4-propylphenyl)-1,2,4-triazole has a molecular weight of 187.25 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-propylphenyl)-1,2,4-triazole is sourced from PubChem (CID 164877919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).