C15H26N2O3 — CID 164878478
[(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl pyrrolidine-1-carboxylate (PubChem CID 164878478) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is [(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl pyrrolidine-1-carboxylate.
| Compound Name | [(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164878478 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl pyrrolidine-1-carboxylate |
| SMILES | COC[C@]12CCCN1[C@@H](COC(=O)N1CCCC1)CC2 |
| InChI | InChI=1S/C15H26N2O3/c1-19-12-15-6-4-10-17(15)13(5-7-15)11-20-14(18)16-8-2-3-9-16/h13H,2-12H2,1H3/t13-,15-/m1/s1 |
| InChIKey | FKCXKZSEIIQGPM-UKRRQHHQSA-N |
| XLogP | 1.86 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |