C12H22N2O3 — CID 164878480
[(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methylcarbamate (PubChem CID 164878480) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is [(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methylcarbamate.
| Compound Name | [(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 164878480 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | [(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OC[C@H]1CC[C@@]2(COC)CCCN12 |
| InChI | InChI=1S/C12H22N2O3/c1-13-11(15)17-8-10-4-6-12(9-16-2)5-3-7-14(10)12/h10H,3-9H2,1-2H3,(H,13,15)/t10-,12-/m1/s1 |
| InChIKey | XWXDQTDNMPKQRT-ZYHUDNBSSA-N |
| XLogP | 0.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |