C13H26N2O2 — CID 164878675
1-[[(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxy]-N,N-dimethylmethanamine (PubChem CID 164878675) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-[[(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxy]-N,N-dimethylmethanamine.
| Compound Name | 1-[[(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxy]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 164878675 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-[[(3R,8R)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxy]-N,N-dimethylmethanamine |
| SMILES | COC[C@]12CCCN1[C@@H](COCN(C)C)CC2 |
| InChI | InChI=1S/C13H26N2O2/c1-14(2)11-17-9-12-5-7-13(10-16-3)6-4-8-15(12)13/h12H,4-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | FSBOLDLXMOGEII-CHWSQXEVSA-N |
| XLogP | 1.17 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|