About 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid
5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid (PubChem CID 164879160) has the molecular formula C17H21FN4O2
and a molecular weight of 332.38 g/mol. Its IUPAC name is 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid |
| PubChem CID | 164879160 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid |
| SMILES | Cc1cc(F)c(N2CCN(c3c(C)n[nH]c3C)CC2)cc1C(=O)O |
| InChI | InChI=1S/C17H21FN4O2/c1-10-8-14(18)15(9-13(10)17(23)24)21-4-6-22(7-5-21)16-11(2)19-20-12(16)3/h8-9H,4-7H2,1-3H3,(H,19,20)(H,23,24) |
| InChIKey | BCOQZZSLRNJWFA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid?
The IUPAC name of 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid (CID 164879160) is 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid.
What is the SMILES notation for 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid?
The canonical SMILES for 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid is Cc1cc(F)c(N2CCN(c3c(C)n[nH]c3C)CC2)cc1C(=O)O.
What is the InChIKey of 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid?
The InChIKey is BCOQZZSLRNJWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN4O2/c1-10-8-14(18)15(9-13(10)17(23)24)21-4-6-22(7-5-21)16-11(2)19-20-12(16)3/h8-9H,4-7H2,1-3H3,(H,19,20)(H,23,24).
What are the key properties of 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid?
5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid has a molecular weight of 332.38 g/mol, XLogP of 2.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-4-fluoro-2-methylbenzoic acid is sourced from PubChem (CID 164879160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).