C13H14ClF2N5O3 — CID 164879360
3-[chloro(difluoro)methoxy]-1-methyl-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]pyrazole-5-carboxamide (PubChem CID 164879360) has the molecular formula C13H14ClF2N5O3 and a molecular weight of 361.74 g/mol. Its IUPAC name is 3-[chloro(difluoro)methoxy]-1-methyl-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]pyrazole-5-carboxamide.
| Compound Name | 3-[chloro(difluoro)methoxy]-1-methyl-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 164879360 |
| Molecular Formula | C13H14ClF2N5O3 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 3-[chloro(difluoro)methoxy]-1-methyl-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]pyrazole-5-carboxamide |
| SMILES | Cn1nc(OC(F)(F)Cl)cc1C(=O)Nc1cc([C@@H]2CCCO2)[nH]n1 |
| InChI | InChI=1S/C13H14ClF2N5O3/c1-21-8(6-11(20-21)24-13(14,15)16)12(22)17-10-5-7(18-19-10)9-3-2-4-23-9/h5-6,9H,2-4H2,1H3,(H2,17,18,19,22)/t9-/m0/s1 |
| InChIKey | ZKCCRJUCHMTFOU-VIFPVBQESA-N |
| XLogP | 2.41 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|