C15H25N5O3S — CID 164879654
cyclopentane;N-methylhydroxylamine;2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide (PubChem CID 164879654) has the molecular formula C15H25N5O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is cyclopentane;N-methylhydroxylamine;2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide.
| Compound Name | cyclopentane;N-methylhydroxylamine;2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 164879654 |
| Molecular Formula | C15H25N5O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | cyclopentane;N-methylhydroxylamine;2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide |
| SMILES | C1CCCC1.CNO.Cc1cc(CC(=O)Nc2cc(=S)[nH][nH]2)on1 |
| InChI | InChI=1S/C9H10N4O2S.C5H10.CH5NO/c1-5-2-6(15-13-5)3-8(14)10-7-4-9(16)12-11-7;1-2-4-5-3-1;1-2-3/h2,4H,3H2,1H3,(H3,10,11,12,14,16);1-5H2;2-3H,1H3 |
| InChIKey | CIBKYAMCUNUHCX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|