About oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine
oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 164879899) has the molecular formula C13H16N6O
and a molecular weight of 272.31 g/mol. Its IUPAC name is oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 164879899 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | C1CCOC1.c1cc(Nc2nccn3nccc23)[nH]n1 |
| InChI | InChI=1S/C9H8N6.C4H8O/c1-4-12-15-6-5-10-9(7(1)15)13-8-2-3-11-14-8;1-2-4-5-3-1/h1-6H,(H2,10,11,13,14);1-4H2 |
| InChIKey | CRDVYKYUYGLUMA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine (CID 164879899) is oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine is C1CCOC1.c1cc(Nc2nccn3nccc23)[nH]n1.
What is the InChIKey of oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is CRDVYKYUYGLUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6.C4H8O/c1-4-12-15-6-5-10-9(7(1)15)13-8-2-3-11-14-8;1-2-4-5-3-1/h1-6H,(H2,10,11,13,14);1-4H2.
What are the key properties of oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine?
oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 272.31 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;N-(1H-pyrazol-5-yl)pyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 164879899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).