About cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea
cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea (PubChem CID 164880052) has the molecular formula C18H30N6O3
and a molecular weight of 378.48 g/mol. Its IUPAC name is cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea.
Molecular Properties
| Compound Name | cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea |
| PubChem CID | 164880052 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea |
| SMILES | C1CCCC1.CC(C)NC(N)=O.Cc1cc(CC(=O)Nc2ccn[nH]2)on1 |
| InChI | InChI=1S/C9H10N4O2.C5H10.C4H10N2O/c1-6-4-7(15-13-6)5-9(14)11-8-2-3-10-12-8;1-2-4-5-3-1;1-3(2)6-4(5)7/h2-4H,5H2,1H3,(H2,10,11,12,14);1-5H2;3H,1-2H3,(H3,5,6,7) |
| InChIKey | ZURXXIQJFDWOHZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea?
The IUPAC name of cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea (CID 164880052) is cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea.
What is the SMILES notation for cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea?
The canonical SMILES for cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea is C1CCCC1.CC(C)NC(N)=O.Cc1cc(CC(=O)Nc2ccn[nH]2)on1.
What is the InChIKey of cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea?
The InChIKey is ZURXXIQJFDWOHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2.C5H10.C4H10N2O/c1-6-4-7(15-13-6)5-9(14)11-8-2-3-10-12-8;1-2-4-5-3-1;1-3(2)6-4(5)7/h2-4H,5H2,1H3,(H2,10,11,12,14);1-5H2;3H,1-2H3,(H3,5,6,7).
What are the key properties of cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea?
cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea has a molecular weight of 378.48 g/mol, XLogP of 2.90, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;2-(3-methyl-1,2-oxazol-5-yl)-N-(1H-pyrazol-5-yl)acetamide;propan-2-ylurea is sourced from PubChem (CID 164880052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).