About N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine
N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine (PubChem CID 164880157) has the molecular formula C16H24N6
and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine |
| PubChem CID | 164880157 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine |
| SMILES | CC(C)(C)n1nc(Nc2ncccn2)cc1[C@H]1CC[C@@H](N)C1 |
| InChI | InChI=1S/C16H24N6/c1-16(2,3)22-13(11-5-6-12(17)9-11)10-14(21-22)20-15-18-7-4-8-19-15/h4,7-8,10-12H,5-6,9,17H2,1-3H3,(H,18,19,20,21)/t11-,12+/m0/s1 |
| InChIKey | WLZPFUDBYZNTDV-NWDGAFQWSA-N |
| XLogP | 2.77 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine?
The IUPAC name of N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine (CID 164880157) is N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine.
What is the SMILES notation for N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine?
The canonical SMILES for N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine is CC(C)(C)n1nc(Nc2ncccn2)cc1[C@H]1CC[C@@H](N)C1.
What is the InChIKey of N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine?
The InChIKey is WLZPFUDBYZNTDV-NWDGAFQWSA-N. The full InChI is InChI=1S/C16H24N6/c1-16(2,3)22-13(11-5-6-12(17)9-11)10-14(21-22)20-15-18-7-4-8-19-15/h4,7-8,10-12H,5-6,9,17H2,1-3H3,(H,18,19,20,21)/t11-,12+/m0/s1.
What are the key properties of N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine?
N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine has a molecular weight of 300.41 g/mol, XLogP of 2.77, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(1S,3R)-3-aminocyclopentyl]-1-tert-butylpyrazol-3-yl]pyrimidin-2-amine is sourced from PubChem (CID 164880157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).