C20H22N2O2S — CID 164880503
(4S)-2-[4-(1,3-dihydroisoindol-2-yl)phenyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 164880503) has the molecular formula C20H22N2O2S and a molecular weight of 354.47 g/mol. Its IUPAC name is (4S)-2-[4-(1,3-dihydroisoindol-2-yl)phenyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-2-[4-(1,3-dihydroisoindol-2-yl)phenyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 164880503 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (4S)-2-[4-(1,3-dihydroisoindol-2-yl)phenyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)SC(c2ccc(N3Cc4ccccc4C3)cc2)N[C@H]1C(=O)O |
| InChI | InChI=1S/C20H22N2O2S/c1-20(2)17(19(23)24)21-18(25-20)13-7-9-16(10-8-13)22-11-14-5-3-4-6-15(14)12-22/h3-10,17-18,21H,11-12H2,1-2H3,(H,23,24)/t17-,18?/m0/s1 |
| InChIKey | WJSCWSXFMPAODZ-ZENAZSQFSA-N |
| XLogP | 3.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|