About 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine
2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 164880589) has the molecular formula C27H31N3
and a molecular weight of 397.57 g/mol. Its IUPAC name is 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine.
Molecular Properties
| Compound Name | 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine |
| PubChem CID | 164880589 |
| Molecular Formula | C27H31N3 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | CN(C)c1ccc2c(c1)CCN(C1CN(C(c3ccccc3)c3ccccc3)C1)C2 |
| InChI | InChI=1S/C27H31N3/c1-28(2)25-14-13-24-18-29(16-15-23(24)17-25)26-19-30(20-26)27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-14,17,26-27H,15-16,18-20H2,1-2H3 |
| InChIKey | RMUGWZRAKWYNAT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine?
The IUPAC name of 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine (CID 164880589) is 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine.
What is the SMILES notation for 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine?
The canonical SMILES for 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine is CN(C)c1ccc2c(c1)CCN(C1CN(C(c3ccccc3)c3ccccc3)C1)C2.
What is the InChIKey of 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine?
The InChIKey is RMUGWZRAKWYNAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N3/c1-28(2)25-14-13-24-18-29(16-15-23(24)17-25)26-19-30(20-26)27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-14,17,26-27H,15-16,18-20H2,1-2H3.
What are the key properties of 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine?
2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine has a molecular weight of 397.57 g/mol, XLogP of 4.58, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzhydrylazetidin-3-yl)-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine is sourced from PubChem (CID 164880589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).