C14H17FN2O6 — CID 164880838
5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-propoxypyrimidin-2-one (PubChem CID 164880838) has the molecular formula C14H17FN2O6 and a molecular weight of 328.30 g/mol. Its IUPAC name is 5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-propoxypyrimidin-2-one.
| Compound Name | 5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-propoxypyrimidin-2-one |
|---|---|
| PubChem CID | 164880838 |
| Molecular Formula | C14H17FN2O6 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-propoxypyrimidin-2-one |
| SMILES | C#Cc1cn([C@@H]2O[C@](F)(CO)[C@@H](O)[C@H]2O)c(=O)nc1OCCC |
| InChI | InChI=1S/C14H17FN2O6/c1-3-5-22-11-8(4-2)6-17(13(21)16-11)12-9(19)10(20)14(15,7-18)23-12/h2,6,9-10,12,18-20H,3,5,7H2,1H3/t9-,10+,12-,14-/m1/s1 |
| InChIKey | YETDMRMRLIXSOW-IQOUGMIPSA-N |
| XLogP | -1.08 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|