C16H19FN2O7 — CID 164880899
[5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl] 2,2-dimethylpropanoate (PubChem CID 164880899) has the molecular formula C16H19FN2O7 and a molecular weight of 370.33 g/mol. Its IUPAC name is [5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 164880899 |
| Molecular Formula | C16H19FN2O7 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl] 2,2-dimethylpropanoate |
| SMILES | C#Cc1cn([C@@H]2O[C@](F)(CO)[C@@H](O)[C@H]2O)c(=O)nc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H19FN2O7/c1-5-8-6-19(12-9(21)10(22)16(17,7-20)26-12)14(24)18-11(8)25-13(23)15(2,3)4/h1,6,9-10,12,20-22H,7H2,2-4H3/t9-,10+,12-,16-/m1/s1 |
| InChIKey | OIAZPIMTJKZUOE-DXCMXYRUSA-N |
| XLogP | -0.92 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|