C13H13FN2O6 — CID 164880927
4-ethenoxy-5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 164880927) has the molecular formula C13H13FN2O6 and a molecular weight of 312.25 g/mol. Its IUPAC name is 4-ethenoxy-5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-ethenoxy-5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 164880927 |
| Molecular Formula | C13H13FN2O6 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-ethenoxy-5-ethynyl-1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C#Cc1cn([C@@H]2O[C@](F)(CO)[C@@H](O)[C@H]2O)c(=O)nc1OC=C |
| InChI | InChI=1S/C13H13FN2O6/c1-3-7-5-16(12(20)15-10(7)21-4-2)11-8(18)9(19)13(14,6-17)22-11/h1,4-5,8-9,11,17-19H,2,6H2/t8-,9+,11-,13-/m1/s1 |
| InChIKey | IMGJODLAWDBIDC-INTNWOOBSA-N |
| XLogP | -1.34 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|