C19H24F2N6O2Si — CID 164881085
2-[[5-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164881085) has the molecular formula C19H24F2N6O2Si and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[[5-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164881085 |
| Molecular Formula | C19H24F2N6O2Si |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[[5-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1ncnc(C2CC2(F)F)c1-c1ncc2c(cnn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C19H24F2N6O2Si/c1-28-18-15(16(23-10-24-18)12-7-19(12,20)21)17-22-9-14-13(26-17)8-25-27(14)11-29-5-6-30(2,3)4/h8-10,12H,5-7,11H2,1-4H3 |
| InChIKey | MWJSDJSRUCVXKQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|