C25H44N4O9P+ — CID 164881788
[4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxybutoxy]-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium;ethane (PubChem CID 164881788) has the molecular formula C25H44N4O9P+ and a molecular weight of 575.62 g/mol. Its IUPAC name is [4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxybutoxy]-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium;ethane.
| Compound Name | [4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxybutoxy]-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium;ethane |
|---|---|
| PubChem CID | 164881788 |
| Molecular Formula | C25H44N4O9P+ |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | [4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxybutoxy]-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium;ethane |
| SMILES | CC.COC(CCn1ccc2c(N)ncnc21)CO[P+](O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H38N4O9P.C2H6/c1-22(2,3)20(28)32-14-35-37(30,36-15-33-21(29)23(4,5)6)34-12-16(31-7)8-10-27-11-9-17-18(24)25-13-26-19(17)27;1-2/h9,11,13,16,30H,8,10,12,14-15H2,1-7H3,(H2,24,25,26);1-2H3/q+1; |
| InChIKey | RLSRXYWCUAVPME-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 166.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|