About 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one
2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one (PubChem CID 164881798) has the molecular formula C10H20O5
and a molecular weight of 220.26 g/mol. Its IUPAC name is 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one.
Molecular Properties
| Compound Name | 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one |
| PubChem CID | 164881798 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one |
| SMILES | COC(C)(C)OC.O=C1CCC(CO)O1 |
| InChI | InChI=1S/C5H8O3.C5H12O2/c6-3-4-1-2-5(7)8-4;1-5(2,6-3)7-4/h4,6H,1-3H2;1-4H3 |
| InChIKey | HXJVTEKRMVNJPJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one?
The IUPAC name of 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one (CID 164881798) is 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one.
What is the SMILES notation for 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one?
The canonical SMILES for 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one is COC(C)(C)OC.O=C1CCC(CO)O1.
What is the InChIKey of 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one?
The InChIKey is HXJVTEKRMVNJPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.C5H12O2/c6-3-4-1-2-5(7)8-4;1-5(2,6-3)7-4/h4,6H,1-3H2;1-4H3.
What are the key properties of 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one?
2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one has a molecular weight of 220.26 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxypropane;5-(hydroxymethyl)oxolan-2-one is sourced from PubChem (CID 164881798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).