C21H34FN3O10P+ — CID 164881902
[5-(4-amino-6-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium (PubChem CID 164881902) has the molecular formula C21H34FN3O10P+ and a molecular weight of 538.49 g/mol. Its IUPAC name is [5-(4-amino-6-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium.
| Compound Name | [5-(4-amino-6-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium |
|---|---|
| PubChem CID | 164881902 |
| Molecular Formula | C21H34FN3O10P+ |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | [5-(4-amino-6-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium |
| SMILES | CC(C)(C)C(=O)OCO[P+](O)(OCOC(=O)C(C)(C)C)OCC1CCC(n2c(F)cc(N)nc2=O)O1 |
| InChI | InChI=1S/C21H33FN3O10P/c1-20(2,3)17(26)30-11-33-36(29,34-12-31-18(27)21(4,5)6)32-10-13-7-8-16(35-13)25-14(22)9-15(23)24-19(25)28/h9,13,16,29H,7-8,10-12H2,1-6H3,(H-,23,24,28)/p+1 |
| InChIKey | KZJHBYBKRUXPNZ-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 170.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|