C17H22N3O6P — CID 164882039
N-[(Z)-1-amino-3-[methyl-[5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]amino]prop-2-enylidene]formamide (PubChem CID 164882039) has the molecular formula C17H22N3O6P and a molecular weight of 395.35 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-[methyl-[5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]amino]prop-2-enylidene]formamide.
| Compound Name | N-[(Z)-1-amino-3-[methyl-[5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]amino]prop-2-enylidene]formamide |
|---|---|
| PubChem CID | 164882039 |
| Molecular Formula | C17H22N3O6P |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[(Z)-1-amino-3-[methyl-[5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]amino]prop-2-enylidene]formamide |
| SMILES | CN(/C=C\C(N)=N\C=O)C1CCC(COP2(=O)OCc3ccccc3O2)O1 |
| InChI | InChI=1S/C17H22N3O6P/c1-20(9-8-16(18)19-12-21)17-7-6-14(25-17)11-24-27(22)23-10-13-4-2-3-5-15(13)26-27/h2-5,8-9,12,14,17H,6-7,10-11H2,1H3,(H2,18,19,21)/b9-8- |
| InChIKey | CDCJYIOHVNJZER-HJWRWDBZSA-N |
| XLogP | 2.18 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|