C18H42N4 — CID 164882612
N,N'-dimethyl-N'-propan-2-ylbutane-1,4-diamine;ethane;7-methyl-4,7-diazaspiro[2.5]octane (PubChem CID 164882612) has the molecular formula C18H42N4 and a molecular weight of 314.56 g/mol. Its IUPAC name is N,N'-dimethyl-N'-propan-2-ylbutane-1,4-diamine;ethane;7-methyl-4,7-diazaspiro[2.5]octane.
| Compound Name | N,N'-dimethyl-N'-propan-2-ylbutane-1,4-diamine;ethane;7-methyl-4,7-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 164882612 |
| Molecular Formula | C18H42N4 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.34 |
| IUPAC Name | N,N'-dimethyl-N'-propan-2-ylbutane-1,4-diamine;ethane;7-methyl-4,7-diazaspiro[2.5]octane |
| SMILES | CC.CN1CCNC2(CC2)C1.CNCCCCN(C)C(C)C |
| InChI | InChI=1S/C9H22N2.C7H14N2.C2H6/c1-9(2)11(4)8-6-5-7-10-3;1-9-5-4-8-7(6-9)2-3-7;1-2/h9-10H,5-8H2,1-4H3;8H,2-6H2,1H3;1-2H3 |
| InChIKey | NUYQIHXOHIJVHH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|