About 1H-[1,4]oxazepino[2,3-c]quinolin-2-one
1H-[1,4]oxazepino[2,3-c]quinolin-2-one (PubChem CID 164883283) has the molecular formula C12H8N2O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is 1H-[1,4]oxazepino[2,3-c]quinolin-2-one.
Molecular Properties
| Compound Name | 1H-[1,4]oxazepino[2,3-c]quinolin-2-one |
| PubChem CID | 164883283 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1H-[1,4]oxazepino[2,3-c]quinolin-2-one |
| SMILES | O=C1C=COc2cnc3ccccc3c2N1 |
| InChI | InChI=1S/C12H8N2O2/c15-11-5-6-16-10-7-13-9-4-2-1-3-8(9)12(10)14-11/h1-7H,(H,14,15) |
| InChIKey | RPDRCFSZTCFTCU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-[1,4]oxazepino[2,3-c]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-[1,4]oxazepino[2,3-c]quinolin-2-one?
The IUPAC name of 1H-[1,4]oxazepino[2,3-c]quinolin-2-one (CID 164883283) is 1H-[1,4]oxazepino[2,3-c]quinolin-2-one.
What is the SMILES notation for 1H-[1,4]oxazepino[2,3-c]quinolin-2-one?
The canonical SMILES for 1H-[1,4]oxazepino[2,3-c]quinolin-2-one is O=C1C=COc2cnc3ccccc3c2N1.
What is the InChIKey of 1H-[1,4]oxazepino[2,3-c]quinolin-2-one?
The InChIKey is RPDRCFSZTCFTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-11-5-6-16-10-7-13-9-4-2-1-3-8(9)12(10)14-11/h1-7H,(H,14,15).
What are the key properties of 1H-[1,4]oxazepino[2,3-c]quinolin-2-one?
1H-[1,4]oxazepino[2,3-c]quinolin-2-one has a molecular weight of 212.21 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-[1,4]oxazepino[2,3-c]quinolin-2-one is sourced from PubChem (CID 164883283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).