About 1,1-dichloro-2,9-dihydrofluorene
1,1-dichloro-2,9-dihydrofluorene (PubChem CID 164883426) has the molecular formula C13H10Cl2
and a molecular weight of 237.13 g/mol. Its IUPAC name is 1,1-dichloro-2,9-dihydrofluorene.
Molecular Properties
| Compound Name | 1,1-dichloro-2,9-dihydrofluorene |
| PubChem CID | 164883426 |
| Molecular Formula | C13H10Cl2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1,1-dichloro-2,9-dihydrofluorene |
| SMILES | ClC1(Cl)CC=CC2=C1Cc1ccccc12 |
| InChI | InChI=1S/C13H10Cl2/c14-13(15)7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h1-6H,7-8H2 |
| InChIKey | YYNWGHJOEDAVQK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-2,9-dihydrofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-2,9-dihydrofluorene?
The IUPAC name of 1,1-dichloro-2,9-dihydrofluorene (CID 164883426) is 1,1-dichloro-2,9-dihydrofluorene.
What is the SMILES notation for 1,1-dichloro-2,9-dihydrofluorene?
The canonical SMILES for 1,1-dichloro-2,9-dihydrofluorene is ClC1(Cl)CC=CC2=C1Cc1ccccc12.
What is the InChIKey of 1,1-dichloro-2,9-dihydrofluorene?
The InChIKey is YYNWGHJOEDAVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2/c14-13(15)7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h1-6H,7-8H2.
What are the key properties of 1,1-dichloro-2,9-dihydrofluorene?
1,1-dichloro-2,9-dihydrofluorene has a molecular weight of 237.13 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-2,9-dihydrofluorene is sourced from PubChem (CID 164883426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).