About tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane
tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane (PubChem CID 164883527) has the molecular formula C21H28FNOSi
and a molecular weight of 357.54 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane |
| PubChem CID | 164883527 |
| Molecular Formula | C21H28FNOSi |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCNC[C@@H]1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28FNOSi/c1-21(2,3)25(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24-20-14-15-23-16-19(20)22/h4-13,19-20,23H,14-16H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | XNJHGTIVPKZJNL-VQTJNVASSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane?
The IUPAC name of tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane (CID 164883527) is tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane.
What is the SMILES notation for tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane?
The canonical SMILES for tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane is CC(C)(C)[Si](O[C@@H]1CCNC[C@@H]1F)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane?
The InChIKey is XNJHGTIVPKZJNL-VQTJNVASSA-N. The full InChI is InChI=1S/C21H28FNOSi/c1-21(2,3)25(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24-20-14-15-23-16-19(20)22/h4-13,19-20,23H,14-16H2,1-3H3/t19-,20+/m0/s1.
What are the key properties of tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane?
tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane has a molecular weight of 357.54 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-diphenylsilane is sourced from PubChem (CID 164883527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).