C11H21N3O2S — CID 164883606
(2S)-1-[(2S)-2-(methylamino)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 164883606) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(methylamino)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-(methylamino)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 164883606 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2S)-1-[(2S)-2-(methylamino)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@@H](CCSC)C(=O)N1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C11H21N3O2S/c1-13-8(5-7-17-2)11(16)14-6-3-4-9(14)10(12)15/h8-9,13H,3-7H2,1-2H3,(H2,12,15)/t8-,9-/m0/s1 |
| InChIKey | HSYUOMNZOMMTNI-IUCAKERBSA-N |
| XLogP | -0.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |