C34H33FN4O — CID 164884015
2-[(S)-1H-benzimidazol-2-yl-[5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-dihydroisoindol-2-yl]methyl]-4-fluorophenol (PubChem CID 164884015) has the molecular formula C34H33FN4O and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-[(S)-1H-benzimidazol-2-yl-[5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-dihydroisoindol-2-yl]methyl]-4-fluorophenol.
| Compound Name | 2-[(S)-1H-benzimidazol-2-yl-[5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-dihydroisoindol-2-yl]methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 164884015 |
| Molecular Formula | C34H33FN4O |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-[(S)-1H-benzimidazol-2-yl-[5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-dihydroisoindol-2-yl]methyl]-4-fluorophenol |
| SMILES | CN1CCC(c2ccc(-c3ccc4c(c3)CN([C@H](c3nc5ccccc5[nH]3)c3cc(F)ccc3O)C4)cc2)CC1 |
| InChI | InChI=1S/C34H33FN4O/c1-38-16-14-24(15-17-38)22-6-8-23(9-7-22)25-10-11-26-20-39(21-27(26)18-25)33(29-19-28(35)12-13-32(29)40)34-36-30-4-2-3-5-31(30)37-34/h2-13,18-19,24,33,40H,14-17,20-21H2,1H3,(H,36,37)/t33-/m0/s1 |
| InChIKey | HJICFRKVLBLQKX-XIFFEERXSA-N |
| XLogP | 6.99 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|