C22H24BF3N2O3 — CID 164884207
N-[(3,5-difluorophenyl)methyl]-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide (PubChem CID 164884207) has the molecular formula C22H24BF3N2O3 and a molecular weight of 432.25 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 164884207 |
| Molecular Formula | C22H24BF3N2O3 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1(C)OB(c2cc3c(cc2F)N(C(=O)NCc2cc(F)cc(F)c2)CC3)OC1(C)C |
| InChI | InChI=1S/C22H24BF3N2O3/c1-21(2)22(3,4)31-23(30-21)17-9-14-5-6-28(19(14)11-18(17)26)20(29)27-12-13-7-15(24)10-16(25)8-13/h7-11H,5-6,12H2,1-4H3,(H,27,29) |
| InChIKey | JDLJOPXYJOZHMK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|