C15H17N5O2 — CID 164884320
4,9-dimethyl-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione (PubChem CID 164884320) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4,9-dimethyl-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione.
| Compound Name | 4,9-dimethyl-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione |
|---|---|
| PubChem CID | 164884320 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4,9-dimethyl-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione |
| SMILES | CC1CN2c3c(c(=O)[nH]c4ncccc34)N(C)C(=O)C2CN1 |
| InChI | InChI=1S/C15H17N5O2/c1-8-7-20-10(6-17-8)15(22)19(2)12-11(20)9-4-3-5-16-13(9)18-14(12)21/h3-5,8,10,17H,6-7H2,1-2H3,(H,16,18,21) |
| InChIKey | DTXINBKIYOUGSC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |