C12H17NO3 — CID 164884511
methyl (2S,3S)-2-(2-formylpyrrol-1-yl)-3-methylpentanoate (PubChem CID 164884511) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl (2S,3S)-2-(2-formylpyrrol-1-yl)-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-(2-formylpyrrol-1-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 164884511 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl (2S,3S)-2-(2-formylpyrrol-1-yl)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)n1cccc1C=O |
| InChI | InChI=1S/C12H17NO3/c1-4-9(2)11(12(15)16-3)13-7-5-6-10(13)8-14/h5-9,11H,4H2,1-3H3/t9-,11-/m0/s1 |
| InChIKey | IZMKHAKWSJRMBC-ONGXEEELSA-N |
| XLogP | 2.06 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|