C10H12F3NO — CID 164884626
2-[5-(1-aminoethyl)-2-fluorophenyl]-2,2-difluoroethanol (PubChem CID 164884626) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-[5-(1-aminoethyl)-2-fluorophenyl]-2,2-difluoroethanol.
| Compound Name | 2-[5-(1-aminoethyl)-2-fluorophenyl]-2,2-difluoroethanol |
|---|---|
| PubChem CID | 164884626 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[5-(1-aminoethyl)-2-fluorophenyl]-2,2-difluoroethanol |
| SMILES | CC(N)c1ccc(F)c(C(F)(F)CO)c1 |
| InChI | InChI=1S/C10H12F3NO/c1-6(14)7-2-3-9(11)8(4-7)10(12,13)5-15/h2-4,6,15H,5,14H2,1H3 |
| InChIKey | BRXAEUYZCDFXQX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |