C20H19FN6O2S — CID 164884904
2-(5-tert-butyl-8-oxo-4-sulfanylidene-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-7-yl)-N-(5-fluoro-2-pyridinyl)acetamide (PubChem CID 164884904) has the molecular formula C20H19FN6O2S and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-(5-tert-butyl-8-oxo-4-sulfanylidene-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-7-yl)-N-(5-fluoro-2-pyridinyl)acetamide.
| Compound Name | 2-(5-tert-butyl-8-oxo-4-sulfanylidene-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-7-yl)-N-(5-fluoro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 164884904 |
| Molecular Formula | C20H19FN6O2S |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-(5-tert-butyl-8-oxo-4-sulfanylidene-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-7-yl)-N-(5-fluoro-2-pyridinyl)acetamide |
| SMILES | CC(C)(C)c1c(=S)[nH]n2c3ncccc3c(=O)n(CC(=O)Nc3ccc(F)cn3)c12 |
| InChI | InChI=1S/C20H19FN6O2S/c1-20(2,3)15-17(30)25-27-16-12(5-4-8-22-16)19(29)26(18(15)27)10-14(28)24-13-7-6-11(21)9-23-13/h4-9H,10H2,1-3H3,(H,25,30)(H,23,24,28) |
| InChIKey | UIGXNMJMACHRSW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|