C22H33FN6O2 — CID 164885407
5-[4-[(7-ethyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydro-1H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 164885407) has the molecular formula C22H33FN6O2 and a molecular weight of 432.54 g/mol. Its IUPAC name is 5-[4-[(7-ethyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydro-1H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[(7-ethyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydro-1H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885407 |
| Molecular Formula | C22H33FN6O2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 5-[4-[(7-ethyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydro-1H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | CCC1CC2NCC(CN3CCN(c4ccc(C(=O)NC)nc4F)CC3)CC2NC1=O |
| InChI | InChI=1S/C22H33FN6O2/c1-3-15-11-17-18(27-21(15)30)10-14(12-25-17)13-28-6-8-29(9-7-28)19-5-4-16(22(31)24-2)26-20(19)23/h4-5,14-15,17-18,25H,3,6-13H2,1-2H3,(H,24,31)(H,27,30) |
| InChIKey | OKPZLYJXEDZRGP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|