C24H38N6O2 — CID 164885410
6-ethyl-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 164885410) has the molecular formula C24H38N6O2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 6-ethyl-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-ethyl-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885410 |
| Molecular Formula | C24H38N6O2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 6-ethyl-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CCc1nc(C(=O)NC)ccc1N1CCN(CC2CCC3NC(CC)C(=O)NC3C2)CC1 |
| InChI | InChI=1S/C24H38N6O2/c1-4-17-22(9-8-20(26-17)23(31)25-3)30-12-10-29(11-13-30)15-16-6-7-19-21(14-16)28-24(32)18(5-2)27-19/h8-9,16,18-19,21,27H,4-7,10-15H2,1-3H3,(H,25,31)(H,28,32) |
| InChIKey | PJQNSMDMAHEISH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |