C23H33F3N6O2 — CID 164885411
5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methyl-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 164885411) has the molecular formula C23H33F3N6O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methyl-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methyl-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885411 |
| Molecular Formula | C23H33F3N6O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methyl-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CCC1NC2CCC(CN3CCN(c4ccc(C(=O)NC)nc4C(F)(F)F)CC3)CC2NC1=O |
| InChI | InChI=1S/C23H33F3N6O2/c1-3-15-22(34)30-18-12-14(4-5-16(18)28-15)13-31-8-10-32(11-9-31)19-7-6-17(21(33)27-2)29-20(19)23(24,25)26/h6-7,14-16,18,28H,3-5,8-13H2,1-2H3,(H,27,33)(H,30,34) |
| InChIKey | WFCIAGDXRVBTAV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |