C23H34F2N6O2 — CID 164885412
6-(difluoromethyl)-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 164885412) has the molecular formula C23H34F2N6O2 and a molecular weight of 464.56 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885412 |
| Molecular Formula | C23H34F2N6O2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 6-(difluoromethyl)-5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CCC1NC2CCC(CN3CCN(c4ccc(C(=O)NC)nc4C(F)F)CC3)CC2NC1=O |
| InChI | InChI=1S/C23H34F2N6O2/c1-3-15-23(33)29-18-12-14(4-5-16(18)27-15)13-30-8-10-31(11-9-30)19-7-6-17(22(32)26-2)28-20(19)21(24)25/h6-7,14-16,18,21,27H,3-5,8-13H2,1-2H3,(H,26,32)(H,29,33) |
| InChIKey | MTTJATZBGTVQRJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |